CAS 7607-72-9
:5-amino-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid
Description:
5-amino-2-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)-5-oxopentanoic acid, with the CAS number 7607-72-9, is a chemical compound that features a complex structure characterized by the presence of an amino group, a pentanoic acid backbone, and a dioxo isoindole moiety. This compound is typically classified as an amino acid derivative due to the presence of the amino group and the carboxylic acid functionality. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of bioactive compounds or as intermediates in organic synthesis. The presence of the dioxo isoindole structure may impart unique properties, such as the ability to participate in various chemical reactions or interactions with biological systems. Additionally, the compound may exhibit specific solubility characteristics and stability under varying pH conditions, which are important for its potential applications. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry, with implications for drug design and development.
Formula:C13H12N2O5
InChI:InChI=1/C13H12N2O5/c14-10(16)6-5-9(13(19)20)15-11(17)7-3-1-2-4-8(7)12(15)18/h1-4,9H,5-6H2,(H2,14,16)(H,19,20)
Synonyms:- 4-carbamoyl-2-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)butanoic acid
- 2-(1,3-Dioxo-2-isoindolyl)glutaramic acid
- 2H-isoindole-2-acetic acid, alpha-(3-amino-3-oxopropyl)-1,3-dihydro-1,3-dioxo-
- alpha-(3-Amino-3-oxopropyl)-1,3-dihydro-1,3-dioxo-2H-isoindole-2-acetic acid
- 2-Phthalimidoglutaramic acid
- Glutaramic acid, 2-phthalimido-, (+-)-
- Ba 2738
- 2H-Isoindole-2-acetic acid, alpha-(3-amino-3-oxopropyl)-1,3-dihydro-1,3-dioxo-, (+-)- (9ci)
- 2H-Isoindole-2-acetic acid, α-(3-amino-3-oxopropyl)-1,3-dihydro-1,3-dioxo-
- 5-Amino-2-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic Acid
- N-Phthaloyl-DL-glutamine
- Glutaramic acid, 2-phthalimido-, DL- (8ci)
- 2-((4-Amino-1-carboxy-4-oxobutyl)carbamoyl)benzoic acid
- N-Phthalyl-DL-glutamine
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2H-Isoindole-2-acetic acid, α-(3-amino-3-oxopropyl)-1,3-dihydro-1,3-dioxo-
CAS:Formula:C13H12N2O5Purity:95%Color and Shape:SolidMolecular weight:276.24485-Amino-2-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic Acid
CAS:5-Amino-2-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic acid is a synthetic derivative that is used as a drug substance. It has been shown to inhibit the activity of glycosylases and eicosatetraynoic acid in human serum. The drug also inhibits the growth of cancer cells in CD-1 mice and humans. 5-Amino-2-(1,3-dioxoisoindolin-2-yl)-5-oxopentanoic acid has been shown to be reactive with hydroxyl ions, nucleophilic attacks, and nucleophilic groups. This drug can be used for the treatment of diseases such as HIV/AIDS and cancer.
Formula:C13H12N2O5Purity:Min. 95%Molecular weight:276.25 g/mol

