CymitQuimica logo

CAS 76075-27-9

:

Imidazo[1,2-a]pyrimidine-2-carboxamide

Description:
Imidazo[1,2-a]pyrimidine-2-carboxamide is a heterocyclic organic compound characterized by its fused imidazole and pyrimidine rings, which contribute to its unique chemical properties. This compound typically exhibits a solid-state structure and is known for its potential biological activity, making it of interest in medicinal chemistry. The presence of the carboxamide functional group enhances its solubility in polar solvents and may influence its interaction with biological targets. Imidazo[1,2-a]pyrimidine derivatives are often studied for their pharmacological properties, including anti-inflammatory, antiviral, and anticancer activities. The compound's molecular structure allows for various substitutions, which can modify its reactivity and biological profile. Additionally, it may participate in hydrogen bonding due to the amide group, affecting its stability and interactions in biological systems. Overall, Imidazo[1,2-a]pyrimidine-2-carboxamide represents a versatile scaffold in drug discovery, with ongoing research aimed at elucidating its mechanisms of action and therapeutic potential.
Formula:C7H6N4O
InChI:InChI=1S/C7H6N4O/c8-6(12)5-4-11-3-1-2-9-7(11)10-5/h1-4H,(H2,8,12)
InChI key:InChIKey=HOEDODNTXLPKFK-UHFFFAOYSA-N
SMILES:C(N)(=O)C=1N=C2N(C1)C=CC=N2
Synonyms:
  • Imidazo[1,2-a]pyrimidine-2-carboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.