CAS 76078-81-4

S-{6-[(2,5-dioxopyrrolidin-1-yl)oxy]-6-oxohexyl} methanesulfonothioate

Description:

S-{6-[(2,5-dioxopyrrolidin-1-yl)oxy]-6-oxohexyl} methanesulfonothioate, with CAS number 76078-81-4, is a chemical compound characterized by its complex structure, which includes a methanesulfonothioate group and a pyrrolidine derivative. This compound typically exhibits properties associated with both sulfonate and thioate functionalities, which can influence its reactivity and solubility in various solvents. The presence of the dioxopyrrolidinyl moiety suggests potential applications in medicinal chemistry, possibly as a prodrug or in the development of pharmaceuticals due to its ability to interact with biological systems. Additionally, the hexyl chain contributes to its hydrophobic characteristics, which may affect its bioavailability and interaction with cellular membranes. Overall, this compound's unique structural features may provide opportunities for specific applications in drug design and synthesis, although detailed studies would be necessary to fully elucidate its behavior and potential uses in various chemical contexts.

Formula: C₁₁H₁₇NO₆S₂

InChI: InChI=1/C11H17NO6S2/c1-20(16,17)19-8-4-2-3-5-11(15)18-12-9(13)6-7-10(12)14/h2-8H2,1H3

SMILES: CS(=O)(=O)SCCCCCC(=O)ON1C(=O)CCC1=O

N-Succinimidyloxycarbonylpentyl Methanethiosulfonate

Controlled Product

CAS: 76078-81-4

Stability Moisture Sensitive: Desiccate
Applications A heterobifunctional sulfhydryl cross-linking reagent.

Formula: C₁₁H₁₇NO₆S₂

Color and Shape: Neat

Molecular weight: 323.39

Ref: TR-S691290