CAS 76079-03-3

N-(3-(2-furyl)acryloyl-ala-lys

Description:

N-(3-(2-furyl)acryloyl)-L-alanine-L-lysine, identified by the CAS number 76079-03-3, is a synthetic compound that features a unique structure combining an acrylamide moiety with amino acids. This compound is characterized by its furan ring, which contributes to its aromatic properties and potential reactivity. The presence of the acrylamide group suggests that it may participate in polymerization reactions, making it of interest in materials science and biochemistry. The amino acid components, L-alanine and L-lysine, impart biological relevance, potentially influencing its interactions in biological systems. This compound may exhibit properties such as solubility in polar solvents, stability under specific conditions, and the ability to form hydrogen bonds due to its functional groups. Its applications could range from drug design to the development of biomaterials, although specific uses would depend on further research into its biological activity and chemical behavior. Overall, N-(3-(2-furyl)acryloyl)-L-alanine-L-lysine represents a versatile compound with potential implications in various fields of chemistry and biochemistry.

Formula: C₁₆H₂₃N₃O₅

InChI: InChI=1/C16H23N3O5/c1-11(18-14(20)8-7-12-5-4-10-24-12)15(21)19-13(16(22)23)6-2-3-9-17/h4-5,7-8,10-11,13H,2-3,6,9,17H2,1H3,(H,18,20)(H,19,21)(H,22,23)/b8-7+/t11-,13-/m0/s1

Synonyms:

• FA-Ala-Lys-OH
• N-[(2E)-3-furan-2-ylprop-2-enoyl]-L-alanyl-L-lysine

N-(3-(2-Furyl)Acryloyl-Ala-Lys TFA salt

CAS: 76079-03-3

FA-Ala-Lys-OH is a lysine derivative with a molecular weight of 243.2 daltons and a pKa of 6.5. It has been shown to be biologically active in humans and animals, and can be used as an amino acid supplement for patients with liver disease or kidney failure who require dialysis. FA-Ala-Lys-OH binds to the creatine kinase receptor on the surface of cells and causes cell lysis, which may be due to its ability to bind to the enzyme's allosteric site. This compound also has anti-viral properties, inhibiting the growth of recombinant virus mcf-7 in vitro by binding to erythrocyte membranes and disrupting protein synthesis. The 6-Fluoro-3-indoxyl beta D galactopyranoside is an antituberculosis drugs that belongs to the class of rifamycins. Rifapentine inhibits bacterial

Formula: C₁₆H₂₃N₃O₅

Purity: Min. 95%

Molecular weight: 337.37 g/mol

Ref: 3D-FF110852