CymitQuimica logo

CAS 76079-45-3

:

N-(4-(4-aminobenzyl)phenyl)-5-norbornene-2,3-dica

Description:
N-(4-(4-aminobenzyl)phenyl)-5-norbornene-2,3-dicarboxylic acid, identified by CAS number 76079-45-3, is a chemical compound that features a norbornene structure, which is a bicyclic compound known for its reactivity and utility in polymer chemistry. This substance contains both amine and carboxylic acid functional groups, contributing to its potential as a building block in organic synthesis and materials science. The presence of the aminobenzyl group suggests that it may exhibit properties such as increased solubility and the ability to form hydrogen bonds, which can enhance its reactivity in various chemical reactions. Additionally, the norbornene moiety allows for potential applications in ring-opening metathesis polymerization (ROMP), making it valuable in the development of advanced materials. Overall, this compound's unique structure and functional groups position it as a versatile intermediate in the synthesis of more complex organic molecules and polymers.
Formula:C22H20N2O2
InChI:InChI=1/C22H20N2O2/c23-17-7-1-13(2-8-17)11-14-3-9-18(10-4-14)24-21(25)19-15-5-6-16(12-15)20(19)22(24)26/h1-10,15-16,19-20H,11-12,23H2
SMILES:c1cc(ccc1Cc1ccc(cc1)N1C(=O)C2C3C=CC(C3)C2C1=O)N
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.