
CAS 76088-46-5
:2,2′-[(3-Methoxypropyl)imino]bis[ethanol]
Description:
2,2′-[(3-Methoxypropyl)imino]bis[ethanol], identified by its CAS number 76088-46-5, is an organic compound characterized by its dual alcohol functional groups and an imine linkage. This substance features a central imino group connecting two ethanol moieties, with a 3-methoxypropyl substituent that enhances its solubility and reactivity. The presence of the methoxy group contributes to its polar nature, making it soluble in various organic solvents and water. The compound is likely to exhibit properties typical of alcohols, such as hydrogen bonding capabilities, which can influence its boiling point and viscosity. Additionally, the imine functionality may impart unique reactivity, allowing it to participate in condensation reactions or serve as a ligand in coordination chemistry. Its potential applications could span from pharmaceuticals to materials science, depending on its reactivity and solubility characteristics. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H19NO3
InChI:InChI=1S/C8H19NO3/c1-12-8-2-3-9(4-6-10)5-7-11/h10-11H,2-8H2,1H3
InChI key:InChIKey=WWFSTEZXAGUMLJ-UHFFFAOYSA-N
SMILES:N(CCCOC)(CCO)CCO
Synonyms:- 2,2′-((3-Methoxypropyl)azanediyl)diethanol
- Ethanol, 2,2′-[(3-methoxypropyl)imino]bis-
- 2-[(2-Hydroxyethyl)(3-methoxypropyl)amino]ethan-1-ol
- 2,2′-[(3-Methoxypropyl)imino]bis[ethanol]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.