
CAS 760933-23-1
:1,3-Dihydro-1-isobenzofurancarboxylic acid
Description:
1,3-Dihydro-1-isobenzofurancarboxylic acid is an organic compound characterized by its bicyclic structure, which includes a fused isobenzofuran ring system and a carboxylic acid functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds, contributing to its unique reactivity and potential applications in organic synthesis. It is likely to be a solid at room temperature, with moderate solubility in polar solvents due to the presence of the carboxylic acid group. The compound may participate in various chemical reactions, including esterification and decarboxylation, making it of interest in the development of pharmaceuticals and agrochemicals. Additionally, its structural features may impart specific biological activities, warranting further investigation in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to mitigate risks associated with its use. Overall, 1,3-Dihydro-1-isobenzofurancarboxylic acid represents a versatile building block in synthetic organic chemistry.
Formula:C9H8O3
InChI:InChI=1S/C9H8O3/c10-9(11)8-7-4-2-1-3-6(7)5-12-8/h1-4,8H,5H2,(H,10,11)
InChI key:InChIKey=HIOSHCHNUDGLDS-UHFFFAOYSA-N
SMILES:C(O)(=O)C1C=2C(CO1)=CC=CC2
Synonyms:- 1,3-Dihydro-2-benzofuran-1-carboxylic acid
- 1-Isobenzofurancarboxylic acid, 1,3-dihydro-
- 1,3-Dihydro-1-isobenzofurancarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.