CymitQuimica logo

CAS 760947-12-4

:

6-Bromo-4-chloro-2-(2-fluorophenyl)quinazoline

Description:
6-Bromo-4-chloro-2-(2-fluorophenyl)quinazoline is a synthetic organic compound belonging to the quinazoline class, which is characterized by a bicyclic structure containing a benzene ring fused to a pyrimidine ring. This compound features several halogen substituents, specifically bromine and chlorine, which can influence its reactivity and biological activity. The presence of a fluorophenyl group enhances its lipophilicity and may contribute to its pharmacological properties. Quinazoline derivatives are often studied for their potential as therapeutic agents, particularly in the fields of oncology and neurology, due to their ability to inhibit specific kinases and other molecular targets. The compound's molecular structure suggests it may exhibit unique interactions with biological systems, making it a subject of interest in medicinal chemistry. Additionally, its CAS number, 760947-12-4, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, the characteristics of this compound make it a valuable candidate for further investigation in drug discovery and development.
Formula:C14H7BrClFN2
InChI:InChI=1S/C14H7BrClFN2/c15-8-5-6-12-10(7-8)13(16)19-14(18-12)9-3-1-2-4-11(9)17/h1-7H
SMILES:c1ccc(c(c1)c1nc2ccc(cc2c(Cl)n1)Br)F
Synonyms:
  • Quinazoline, 6-bromo-4-chloro-2-(2-fluorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.