CymitQuimica logo

CAS 760995-53-7

:

2,3-Dihydro-5-(hydroxymethyl)-1H-inden-1-one

Description:
2,3-Dihydro-5-(hydroxymethyl)-1H-inden-1-one, identified by its CAS number 760995-53-7, is an organic compound characterized by its bicyclic structure, which includes an indene moiety. This compound features a hydroxymethyl group (-CH2OH) at the 5-position and a ketone functional group (C=O) at the 1-position of the indene ring. The presence of these functional groups contributes to its reactivity and potential applications in organic synthesis. Typically, compounds like this may exhibit properties such as solubility in organic solvents, moderate stability under standard conditions, and the ability to participate in various chemical reactions, including nucleophilic additions and condensation reactions. The hydroxymethyl group can also serve as a site for further functionalization, making it a versatile intermediate in the synthesis of more complex molecules. Additionally, the compound may possess biological activity, although specific pharmacological properties would require further investigation. Overall, 2,3-Dihydro-5-(hydroxymethyl)-1H-inden-1-one is of interest in both synthetic organic chemistry and potential medicinal chemistry applications.
Formula:C10H10O2
InChI:InChI=1S/C10H10O2/c11-6-7-1-3-9-8(5-7)2-4-10(9)12/h1,3,5,11H,2,4,6H2
InChI key:InChIKey=UQIAUOXNGRZQNP-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(CO)=CC2)CC1
Synonyms:
  • 5-(Hydroxymethyl)indan-1-one
  • 1H-Inden-1-one, 2,3-dihydro-5-(hydroxymethyl)-
  • 2,3-Dihydro-5-(hydroxymethyl)-1H-inden-1-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.