CAS 76101-14-9
:Methyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-β-D-glucopyranoside
Description:
Methyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-β-D-glucopyranoside, with the CAS number 76101-14-9, is a chemical compound that features a glucopyranoside structure, which is a sugar derivative. This compound is characterized by the presence of a methyl group and a unique isoindole moiety, which contributes to its potential biological activity. The dioxo-isoindole structure suggests that it may exhibit interesting properties, possibly including antioxidant or antimicrobial activities, although specific biological effects would require empirical investigation. The glucopyranoside part indicates that it is likely soluble in water and may participate in various biochemical interactions, making it relevant in fields such as medicinal chemistry and biochemistry. Its synthesis and reactivity can be influenced by the functional groups present, and it may serve as a useful intermediate in organic synthesis or as a probe in biological studies. As with many complex organic compounds, its stability, reactivity, and interactions would depend on the specific conditions under which it is studied.
Formula:C15H17NO7
InChI:InChI=1/C15H17NO7/c1-22-15-10(12(19)11(18)9(6-17)23-15)16-13(20)7-4-2-3-5-8(7)14(16)21/h2-5,9-12,15,17-19H,6H2,1H3
InChI key:InChIKey=DYRBBRIJDAJADF-ACVJOUTJSA-N
SMILES:O=C1N(C(=O)C=2C1=CC=CC2)[C@H]3[C@H](OC)O[C@H](CO)[C@@H](O)[C@@H]3O
Synonyms:- Glucopyranoside, methyl 2-deoxy-2-phthalimido-, β-D-
- Methyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-β-D-glucopyranoside
- NSC 350991
- β-D-Glucopyranoside, methyl 2-deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Methyl 2-deoxy-2-phthalimido-β-D-glucopyranoside
CAS:Methyl 2-deoxy-2-phthalimido-b-D-glucopyranoside is a synthetic sugar that has been modified with fluorine. It is an important building block for the synthesis of complex carbohydrates. Methyl 2-deoxy-2-phthalimido-b-D-glucopyranoside can be used to modify saccharides and oligosaccharides, as well as to add fluorine atoms to glycosyl units. This modification can be done using a click chemistry reaction with azide functionalized molecules. The chemical structure of Methyl 2-deoxy-2-phthalimido-b-D-glucopyranoside is shown below:Formula:C15H17NO7Purity:Min. 95%Color and Shape:White to off-white solid.Molecular weight:323.3 g/mol

