CymitQuimica logo

CAS 76102-92-6

:

2-amino-N-(pyridin-3-yl)benzamide

Description:
2-amino-N-(pyridin-3-yl)benzamide, with the CAS number 76102-92-6, is an organic compound characterized by its amine and amide functional groups. It features a benzamide structure where an amino group is attached to the benzene ring, and a pyridine ring is substituted at the nitrogen of the amide. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the amine and amide functionalities, which can engage in hydrogen bonding. It may also display biological activity, making it of interest in medicinal chemistry and drug development. The presence of the pyridine ring can influence its electronic properties and reactivity, potentially allowing for interactions with biological targets. Additionally, the compound may exhibit specific melting and boiling points, which are important for its characterization and application in various chemical processes. Overall, 2-amino-N-(pyridin-3-yl)benzamide is a versatile compound with potential applications in pharmaceuticals and organic synthesis.
Formula:C12H11N3O
InChI:InChI=1/C12H11N3O/c13-11-6-2-1-5-10(11)12(16)15-9-4-3-7-14-8-9/h1-8H,13H2,(H,15,16)
InChI key:KNACUADYYQPXOO-UHFFFAOYSA-N
SMILES:c1ccc(c(c1)C(=Nc1cccnc1)O)N
Synonyms:
  • benzamide, 2-amino-N-3-pyridinyl-
Found 4 products.