
CAS 76104-57-9
:1-(3-Bromopropyl)-2,4-dimethoxybenzene
Description:
1-(3-Bromopropyl)-2,4-dimethoxybenzene, with the CAS number 76104-57-9, is an organic compound characterized by its aromatic structure and the presence of both bromine and methoxy functional groups. This compound features a bromopropyl group attached to a benzene ring that is further substituted with two methoxy groups at the 2 and 4 positions. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity, while the methoxy groups enhance its solubility in organic solvents and may affect its electronic properties. Typically, compounds like this can be utilized in organic synthesis, potentially serving as intermediates in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure. Safety data should be consulted for handling, as brominated compounds can pose health risks.
Formula:C11H15BrO2
InChI:InChI=1S/C11H15BrO2/c1-13-10-6-5-9(4-3-7-12)11(8-10)14-2/h5-6,8H,3-4,7H2,1-2H3
InChI key:InChIKey=ACWYPBHRTFZGHF-UHFFFAOYSA-N
SMILES:C(CCBr)C1=C(OC)C=C(OC)C=C1
Synonyms:- 1-(3-Bromopropyl)-2,4-dimethoxybenzene
- Benzene, 1-(3-bromopropyl)-2,4-dimethoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.