CymitQuimica logo

CAS 7611-43-0

:

Lycomarasmine

Description:
Lycomarasmine, with the CAS number 7611-43-0, is a chemical compound that belongs to the class of alkaloids. It is primarily derived from certain plant species, particularly those in the Solanaceae family. This compound is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, which have garnered interest in pharmacological research. Lycomarasmine typically exhibits a complex molecular structure, characterized by specific functional groups that contribute to its reactivity and interaction with biological systems. Its solubility and stability can vary depending on environmental conditions, such as pH and temperature. As with many alkaloids, it may also display a range of effects on human health, necessitating careful study to understand its mechanisms of action and potential therapeutic applications. However, detailed information regarding its toxicity, pharmacokinetics, and specific applications in medicine or industry may require further investigation and validation through scientific research.
Formula:C9H15N3O7
InChI:InChI=1S/C9H15N3O7/c10-6(13)3-12-5(9(18)19)2-11-4(8(16)17)1-7(14)15/h4-5,11-12H,1-3H2,(H2,10,13)(H,14,15)(H,16,17)(H,18,19)
InChI key:InChIKey=YRSDOJQPYZOCMY-UHFFFAOYSA-N
SMILES:C(CNC(CC(O)=O)C(O)=O)(NCC(N)=O)C(O)=O
Synonyms:
  • Lycomarasmine B
  • Lycomarasmine
  • Welkstoff
  • L-Aspartic acid, N-[2-[(2-amino-2-oxoethyl)amino]-2-carboxyethyl]-
  • N-[2-[(2-Amino-2-oxoethyl)amino]-2-carboxyethyl]-L-aspartic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.