CAS 76111-71-2
:2-(1,3-benzoxazol-2-ylsulfanyl)ethanamine
Description:
2-(1,3-benzoxazol-2-ylsulfanyl)ethanamine, identified by its CAS number 76111-71-2, is a chemical compound that features a benzoxazole ring, which is a bicyclic structure containing both benzene and oxazole moieties. This compound is characterized by the presence of a sulfanyl (thioether) group attached to the benzoxazole, as well as an ethanamine functional group, which contributes to its potential biological activity. The presence of the sulfanyl group may enhance its reactivity and solubility in various solvents. This compound may exhibit properties such as fluorescence or photostability due to the aromatic nature of the benzoxazole ring. It is of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the structural features suggest that it may participate in hydrogen bonding and other intermolecular interactions, which could influence its behavior in biological systems. As with many organic compounds, its stability, reactivity, and biological activity would depend on the specific conditions under which it is studied.
Formula:C9H10N2OS
InChI:InChI=1/C9H10N2OS/c10-5-6-13-9-11-7-3-1-2-4-8(7)12-9/h1-4H,5-6,10H2
SMILES:c1ccc2c(c1)nc(o2)SCCN
Synonyms:- Ethanamine, 2-(2-Benzoxazolylthio)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.