CAS 7612-88-6
:4-(bromomethyl)benzenesulfonyl fluoride
Description:
4-(Bromomethyl)benzenesulfonyl fluoride, with the CAS number 7612-88-6, is an organic compound characterized by the presence of a sulfonyl fluoride functional group attached to a benzene ring that also bears a bromomethyl substituent. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the sulfonyl fluoride group, which can act as a potent electrophile in various chemical reactions, including nucleophilic substitutions. The bromomethyl group enhances its utility in synthetic organic chemistry, allowing for further functionalization. This compound is often used in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Safety precautions are essential when handling this substance, as it may be toxic and can cause irritation to the skin, eyes, and respiratory system. Proper storage and disposal methods should be followed to mitigate environmental and health risks.
Formula:C7H6BrFO2S
InChI:InChI=1/C7H6BrFO2S/c8-5-6-1-3-7(4-2-6)12(9,10)11/h1-4H,5H2
SMILES:c1cc(ccc1CBr)S(=O)(=O)F
Synonyms:- Benzenesulfonyl fluoride, 4-(bromomethyl)-
- p-Toluenesulfonyl fluoride, alpha-bromo-
- 4-(Bromomethyl)benzenesulfonyl fluoride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(Bromomethyl)Benzenesulfonyl Fluoride
CAS:4-(Bromomethyl)Benzenesulfonyl FluoridePurity:97%Molecular weight:253.09g/mol4-(Bromomethyl)benzenesulfonyl fluoride
CAS:4-(Bromomethyl)benzenesulfonyl fluoride (BMF) is a covalent inhibitor that binds to the active site of serum albumin and reversibly inhibits the enzyme. It has been shown to be an effective inhibitor, with low toxicity and high specificity for human serum albumin. BMF has been shown to inhibit the synthesis of glycosaminoglycans in human fibroblast cells. It also inhibits cellular protein synthesis and reduces the amount of albumin in serum.Formula:C7H6BrFO2SPurity:Min. 95%Molecular weight:253.09 g/mol


