CAS 76123-09-6

4-Ethenylcyclohexanol

Description:

4-Ethenylcyclohexanol is an organic compound characterized by its cyclohexane ring with a vinyl group (ethenyl) and a hydroxyl group (alcohol) attached to it. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is soluble in organic solvents and exhibits moderate solubility in water due to the presence of the hydroxyl group. The compound is known for its reactivity, particularly in polymerization reactions, where the vinyl group can participate in various addition reactions. Its chemical structure allows for potential applications in the synthesis of polymers and other organic compounds. Additionally, 4-Ethenylcyclohexanol may exhibit properties such as moderate volatility and a relatively low boiling point, making it useful in various industrial applications. Safety considerations should be taken into account, as with many organic compounds, including proper handling and storage to avoid exposure. Overall, 4-Ethenylcyclohexanol is a versatile compound with potential utility in chemical synthesis and materials science.

Formula: C₈H₁₄O

InChI: InChI=1S/C8H14O/c1-2-7-3-5-8(9)6-4-7/h2,7-9H,1,3-6H2

InChI key: InChIKey=MYKPQTQXWQAXPP-UHFFFAOYSA-N

SMILES: C(=C)C1CCC(O)CC1

Synonyms:

• 4-Ethenylcyclohexanol
• Cyclohexanol, 4-vinyl-
• 4-Vinylcyclohexanol
• Cyclohexanol, 4-ethenyl-