CymitQuimica logo

CAS 76128-72-8

:

4-Bromo-2-(3-fluorophenyl)pyrimidine

Description:
4-Bromo-2-(3-fluorophenyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 4-position and a 3-fluorophenyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, making it useful in various chemical reactions and applications. Its structure suggests potential reactivity due to the halogen substituents, which can participate in nucleophilic substitution reactions. Additionally, the fluorine atom can influence the compound's electronic properties and lipophilicity, potentially affecting its biological activity. 4-Bromo-2-(3-fluorophenyl)pyrimidine is of interest in medicinal chemistry and material science, where it may serve as a building block for the synthesis of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C10H6BrFN2
InChI:InChI=1S/C10H6BrFN2/c11-9-4-5-13-10(14-9)7-2-1-3-8(12)6-7/h1-6H
InChI key:InChIKey=BFBYHKXDGJAGJY-UHFFFAOYSA-N
SMILES:FC=1C=C(C=CC1)C=2N=C(Br)C=CN2
Synonyms:
  • Pyrimidine, 4-bromo-2-(3-fluorophenyl)-
  • 4-Bromo-2-(3-fluorophenyl)pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.