CAS 76128-73-9
:4-Bromo-2-(4-fluorophenyl)pyrimidine
Description:
4-Bromo-2-(4-fluorophenyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 4-position and a para-fluorophenyl group at the 2-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents. It exhibits potential biological activity, making it of interest in pharmaceutical research, particularly in the development of new drugs. The bromine and fluorine substituents can influence the compound's reactivity, stability, and interaction with biological targets. Additionally, the presence of halogens often enhances lipophilicity, which can affect the compound's absorption and distribution in biological systems. As with many pyrimidine derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and usage, as halogenated compounds can pose health risks.
Formula:C10H6BrFN2
InChI:InChI=1S/C10H6BrFN2/c11-9-5-6-13-10(14-9)7-1-3-8(12)4-2-7/h1-6H
InChI key:InChIKey=GSYPOPGUJPCOCY-UHFFFAOYSA-N
SMILES:BrC1=NC(=NC=C1)C2=CC=C(F)C=C2
Synonyms:- Pyrimidine, 4-bromo-2-(4-fluorophenyl)-
- 4-Bromo-2-(4-fluorophenyl)pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.