CAS 76139-30-5

1-(4-bromophenyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-1,3,8-triazaspiro[4.5]decan-4-one

Description:

1-(4-bromophenyl)-8-[4-(4-fluorophenyl)-4-oxobutyl]-1,3,8-triazaspiro[4.5]decan-4-one is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both nitrogen and carbon atoms. The presence of a triaza moiety indicates that the compound contains three nitrogen atoms within its cyclic framework, contributing to its potential biological activity. The bromine and fluorine substituents on the phenyl groups enhance the compound's lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit interesting pharmacological properties due to its structural features, which may include anti-inflammatory or anticancer activities, although specific biological data would be necessary to confirm such effects. Additionally, the presence of a ketone functional group suggests potential reactivity in various chemical reactions. Overall, this compound's unique structural characteristics make it a subject of interest in medicinal chemistry and drug development.

Formula: C₂₃H₂₅BrFN₃O₂

InChI: InChI=1/C23H25BrFN3O2/c24-18-5-9-20(10-6-18)28-16-26-22(30)23(28)11-14-27(15-12-23)13-1-2-21(29)17-3-7-19(25)8-4-17/h3-10H,1-2,11-16H2,(H,26,30)

SMILES: C(CC(=O)c1ccc(cc1)F)CN1CCC2(CC1)C(=NCN2c1ccc(cc1)Br)O