CymitQuimica logo

CAS 761390-58-3

:

(R)-1-(3-Fluorophenyl)ethylamine

Description:
(R)-1-(3-Fluorophenyl)ethylamine is an organic compound characterized by its chiral center, which contributes to its enantiomeric properties. The presence of a fluorine atom on the phenyl ring enhances its lipophilicity and can influence its biological activity. This compound features an ethylamine moiety, which is known for its role in various biochemical processes and potential applications in pharmaceuticals. The (R) configuration indicates the specific spatial arrangement of atoms around the chiral center, which can significantly affect the compound's interaction with biological targets, such as receptors or enzymes. As a result, (R)-1-(3-Fluorophenyl)ethylamine may exhibit distinct pharmacological properties compared to its (S) counterpart. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of drugs targeting neurological or psychiatric disorders. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine substituent, making it a subject of interest in synthetic organic chemistry and drug design.
Formula:C8H10FN
InChI:InChI=1S/C8H10FN/c1-6(10)7-3-2-4-8(9)5-7/h2-6H,10H2,1H3/t6-/m1/s1
InChI key:ASNVMKIDRJZXQZ-ZCFIWIBFSA-N
SMILES:C[C@H](C1=CC(=CC=C1)F)N
Found 4 products.