CymitQuimica logo

CAS 761440-06-6

:

1H-Isoindol-1-one,7-amino-2,3-dihydro-2-methyl-

Description:
1H-Isoindol-1-one, 7-amino-2,3-dihydro-2-methyl- is a chemical compound characterized by its isoindole structure, which features a fused benzene and pyrrole ring. This compound contains an amino group at the 7-position and a methyl group at the 2-position, contributing to its unique reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amino group suggests potential for hydrogen bonding and reactivity in various chemical reactions, making it of interest in medicinal chemistry and drug development. Its molecular structure may allow for interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, safety and handling precautions should be observed, as the compound may have specific toxicity or reactivity profiles. Further studies would be necessary to fully elucidate its properties and potential uses in various fields.
Formula:C9H10N2O
InChI:InChI=1S/C9H10N2O/c1-11-5-6-3-2-4-7(10)8(6)9(11)12/h2-4H,5,10H2,1H3
InChI key:JPARDNRMCTVFJO-UHFFFAOYSA-N
SMILES:CN1CC2=C(C1=O)C(=CC=C2)N
Synonyms:
  • 4-Amino-2-methyl-2,3-dihydro-1H-isoindol-3-one
  • 7-Amino-N-methyl-2,3-dihydroisoindole-1-one
Found 5 products.