
CAS 761440-17-9
:2,5-Dichloro-N-[2-(ethylsulfonyl)phenyl]-4-pyrimidinamine
Description:
2,5-Dichloro-N-[2-(ethylsulfonyl)phenyl]-4-pyrimidinamine is a chemical compound characterized by its specific molecular structure, which includes a pyrimidine ring substituted with dichloro and an ethylsulfonyl phenyl group. This compound typically exhibits properties associated with its functional groups, such as potential solubility in polar solvents due to the sulfonyl moiety. The presence of chlorine atoms may influence its reactivity and biological activity, often enhancing its interaction with biological targets. It may also display moderate to high stability under standard conditions, although specific stability can depend on environmental factors. The compound is likely to be of interest in pharmaceutical research, particularly in the development of therapeutic agents, due to its unique structural features that may confer specific biological activities. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or environmental impact. Always refer to material safety data sheets (MSDS) and relevant literature for detailed safety and handling information.
Formula:C12H11Cl2N3O2S
InChI:InChI=1S/C12H11Cl2N3O2S/c1-2-20(18,19)10-6-4-3-5-9(10)16-11-8(13)7-15-12(14)17-11/h3-7H,2H2,1H3,(H,15,16,17)
InChI key:InChIKey=ZBIGXRRIWFOTQE-UHFFFAOYSA-N
SMILES:N(C1=C(S(CC)(=O)=O)C=CC=C1)C=2C(Cl)=CN=C(Cl)N2
Synonyms:- 4-Pyrimidinamine, 2,5-dichloro-N-[2-(ethylsulfonyl)phenyl]-
- 2,5-Dichloro-N-[2-(ethylsulfonyl)phenyl]-4-pyrimidinamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
