CymitQuimica logo

CAS 761440-58-8

:

1-(3-Methoxy-4-nitrophenyl)-3-pyrrolidinol

Description:
1-(3-Methoxy-4-nitrophenyl)-3-pyrrolidinol, with the CAS number 761440-58-8, is a chemical compound characterized by its unique structural features. It consists of a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle, attached to a phenyl group that is further substituted with a methoxy group and a nitro group. The presence of the methoxy group contributes to the compound's electron-donating properties, while the nitro group is an electron-withdrawing substituent, influencing the compound's reactivity and polarity. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Additionally, the compound's functional groups can participate in various chemical reactions, including nucleophilic substitutions and reductions. Overall, 1-(3-Methoxy-4-nitrophenyl)-3-pyrrolidinol is a complex molecule with potential applications in research and development within the fields of organic synthesis and drug discovery.
Formula:C11H14N2O4
InChI:InChI=1S/C11H14N2O4/c1-17-11-6-8(2-3-10(11)13(15)16)12-5-4-9(14)7-12/h2-3,6,9,14H,4-5,7H2,1H3
InChI key:InChIKey=IRPVQBHMMZEOMC-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1N(=O)=O)N2CCC(O)C2
Synonyms:
  • 1-(3-Methoxy-4-nitrophenyl)-3-pyrrolidinol
  • 3-Pyrrolidinol, 1-(3-methoxy-4-nitrophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.