
CAS 761441-15-0
:5-Methoxy-2-(2-methoxyethoxy)benzenamine
Description:
5-Methoxy-2-(2-methoxyethoxy)benzenamine, with the CAS number 761441-15-0, is an organic compound characterized by its aromatic amine structure. It features a methoxy group (-OCH3) and a 2-methoxyethoxy group, which contribute to its solubility and reactivity. The presence of the amine functional group (-NH2) indicates potential basicity and nucleophilicity, making it reactive in various chemical reactions, such as electrophilic aromatic substitution. This compound is likely to exhibit moderate polarity due to the methoxy and ethoxy groups, which can influence its interactions with solvents and biological systems. Additionally, the methoxy groups can enhance the compound's lipophilicity, potentially affecting its pharmacokinetic properties if considered for pharmaceutical applications. Overall, 5-Methoxy-2-(2-methoxyethoxy)benzenamine's unique structure suggests it may have interesting chemical behavior and potential utility in various fields, including medicinal chemistry and materials science.
Formula:C10H15NO3
InChI:InChI=1S/C10H15NO3/c1-12-5-6-14-10-4-3-8(13-2)7-9(10)11/h3-4,7H,5-6,11H2,1-2H3
InChI key:InChIKey=KRFLXEYSMNRRAI-UHFFFAOYSA-N
SMILES:O(CCOC)C1=C(N)C=C(OC)C=C1
Synonyms:- Benzenamine, 5-methoxy-2-(2-methoxyethoxy)-
- 5-Methoxy-2-(2-methoxyethoxy)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.