CAS 76145-76-1
:Tomoxiprole
Description:
Tomoxiprole, with the CAS number 76145-76-1, is a chemical compound that belongs to the class of substances known as phenylpyrroles. It is primarily recognized for its application as a fungicide, particularly in agricultural settings. Tomoxiprole exhibits a broad spectrum of activity against various fungal pathogens, making it valuable in crop protection. The compound functions by inhibiting specific biochemical pathways in fungi, thereby preventing their growth and reproduction. In terms of its physical properties, Tomoxiprole is typically characterized by its stability under normal environmental conditions, although its solubility and volatility can vary based on formulation and environmental factors. Safety assessments indicate that, like many agrochemicals, it should be handled with care to minimize potential risks to human health and the environment. Regulatory evaluations often focus on its efficacy, environmental impact, and toxicological profile to ensure safe usage in agricultural practices.
Formula:C21H20N2O
InChI:InChI=1/C21H20N2O/c1-13(2)18-12-15-6-4-5-7-17(15)19-20(18)23-21(22-19)14-8-10-16(24-3)11-9-14/h4-13H,1-3H3,(H,22,23)
Synonyms:- 1H-naphth[1,2-d]imidazole, 2-(4-methoxyphenyl)-4-(1-methylethyl)-
- 76145-76-1
- 2-(4-methoxyphenyl)-4-(propan-2-yl)-1H-naphtho[1,2-d]imidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tomoxiprole
CAS:Tomoxiprole is a cyclooxygenase-2-selective inhibitor.Formula:C21H20N2OColor and Shape:SolidMolecular weight:316.4
