CAS 76145-90-9

2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1H-benzimidazole

Description:

2-[1,2,2,2-tetrafluoro-1-[1,1,2,3,3,3-hexafluoro-2-(1,1,2,2,3,3,3-heptafluoropropoxy)propoxy]ethyl]-1H-benzimidazole, with CAS number 76145-90-9, is a complex fluorinated organic compound. It features a benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings, contributing to its potential biological activity. The presence of multiple fluorinated groups, including tetrafluoro and hexafluoro moieties, enhances its chemical stability and lipophilicity, making it useful in various applications, particularly in the field of pharmaceuticals and agrochemicals. The fluorinated segments can also impart unique properties such as increased resistance to degradation and altered solubility profiles. This compound may exhibit specific interactions with biological targets due to its structural characteristics, which could be of interest in medicinal chemistry. However, detailed studies on its toxicity, environmental impact, and specific applications would be necessary to fully understand its behavior and utility in practical scenarios.

Formula: C₁₅H₅F₁₇N₂O₂

InChI: InChI=1/C15H5F17N2O2/c16-8(11(20,21)22,7-33-5-3-1-2-4-6(5)34-7)35-15(31,32)10(19,13(26,27)28)36-14(29,30)9(17,18)12(23,24)25/h1-4H,(H,33,34)

SMILES: c1ccc2c(c1)nc(C(C(F)(F)F)(F)OC(C(C(F)(F)F)(F)OC(C(C(F)(F)F)(F)F)(F)F)(F)F)[nH]2

2-[Perfluoro(5-methyl-3,6-dioxanonan-2-yl)]-1H-benzimidazole

CAS: 76145-90-9

2-[Perfluoro(5-methyl-3,6-dioxanonan-2-yl)]-1H-benzimidazole

Purity: ≥95%

Molecular weight: 568.19g/mol

Ref: 54-PC6892