CAS 76145-91-0

6-Pteridinemethanol, 2,4-diamino-, hydrobromide (1:?)

Description:

6-Pteridinemethanol, 2,4-diamino-, hydrobromide (CAS 76145-91-0) is a chemical compound that belongs to the class of pteridine derivatives. It is characterized by the presence of a pteridine ring, which is a bicyclic structure containing nitrogen atoms, and features hydroxymethyl and amino functional groups. The hydrobromide form indicates that the compound is a salt formed with hydrobromic acid, which can enhance its solubility in water and influence its biological activity. This compound may exhibit properties relevant to medicinal chemistry, particularly in the context of pharmaceuticals, as pteridine derivatives are often investigated for their roles in various biological processes, including enzyme inhibition and as potential therapeutic agents. Its specific applications and biological activities would depend on further studies and context within medicinal chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₇H₈N₆O·xBrH

InChI: InChI=1S/C7H8N6O.BrH/c8-5-4-6(13-7(9)12-5)10-1-3(2-14)11-4;/h1,14H,2H2,(H4,8,9,10,12,13);1H

InChI key: InChIKey=GLCVATFASXGJHN-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=C(N)N1)N=CC(CO)=N2.Br

Synonyms:

• 6-Pteridinemethanol, 2,4-diamino-, hydrobromide (1:?)
• (2,4-Diaminopteridin-6-yl)methanol hydrobromide
• 6-Pteridinemethanol, 2,4-diamino-, hydrobromide