CAS 76148-93-1
:3-(4-methoxyphenyl)-2H-1,4-benzothiazine
Description:
3-(4-Methoxyphenyl)-2H-1,4-benzothiazine, identified by its CAS number 76148-93-1, is a chemical compound that belongs to the class of benzothiazines, which are characterized by a benzene ring fused to a thiazine ring. This compound features a methoxy group attached to a phenyl ring, contributing to its unique properties. Typically, benzothiazines exhibit a range of biological activities, including potential anti-inflammatory and analgesic effects, making them of interest in medicinal chemistry. The presence of the methoxy group can enhance lipophilicity, potentially influencing the compound's pharmacokinetics and bioavailability. In terms of physical properties, compounds in this class may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. The structural characteristics of 3-(4-methoxyphenyl)-2H-1,4-benzothiazine suggest it may participate in various chemical reactions, including electrophilic substitutions and nucleophilic attacks, making it a versatile compound for further research and development in pharmaceutical applications.
Formula:C15H13NOS
InChI:InChI=1/C15H13NOS/c1-17-12-8-6-11(7-9-12)14-10-18-15-5-3-2-4-13(15)16-14/h2-9H,10H2,1H3
Synonyms:- 3-(4-Methoxyphenyl)-2H-1,4-benzothiazin
- 2H-1,4-benzothiazine, 3-(4-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.