CAS 76160-34-4

(2-bromophenyl)(pyridin-2-yl)methanone

Description:

(2-bromophenyl)(pyridin-2-yl)methanone, identified by its CAS number 76160-34-4, is an organic compound characterized by the presence of a bromine atom attached to a phenyl ring and a ketone functional group. This compound features a pyridine ring, which contributes to its aromaticity and potential for various chemical interactions. The bromine substituent can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and material science. The presence of both the phenyl and pyridine rings suggests that the compound may exhibit interesting electronic properties and biological activity, potentially serving as a scaffold for drug development. Additionally, the ketone functional group indicates that it may participate in nucleophilic addition reactions. Overall, (2-bromophenyl)(pyridin-2-yl)methanone is a versatile compound with applications in research and industry, particularly in the synthesis of more complex organic molecules.

Formula: C₁₂H₈BrNO

InChI: InChI=1/C12H8BrNO/c13-10-6-2-1-5-9(10)12(15)11-7-3-4-8-14-11/h1-8H

SMILES: c1ccc(c(c1)C(=O)c1ccccn1)Br

Synonyms:

• 2-(2-Bromobenzoyl)pyridine
• Methanone, (2-bromophenyl)-2-pyridinyl-