CAS 76172-68-4

3-(4-Methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone

Description:

3-(4-Methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone, identified by its CAS number 76172-68-4, is an organic compound characterized by its complex structure featuring a propanone backbone substituted with aromatic rings. The presence of a methoxy group on one phenyl ring enhances its solubility and reactivity, while the tri-hydroxy substitution on the other phenyl ring contributes to its potential antioxidant properties. This compound may exhibit interesting biological activities due to the presence of multiple hydroxyl groups, which can facilitate hydrogen bonding and enhance interactions with biological targets. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents. Its stability, reactivity, and solubility in various solvents can vary based on environmental conditions, making it a subject of interest in both synthetic and medicinal chemistry. Further studies would be necessary to fully elucidate its properties and potential applications in various fields.

Formula: C₁₆H₁₆O₅

InChI: InChI=1S/C16H16O5/c1-21-12-5-2-10(3-6-12)4-7-13(18)16-14(19)8-11(17)9-15(16)20/h2-3,5-6,8-9,17,19-20H,4,7H2,1H3

InChI key: InChIKey=YQNPVOBVGNGYHD-UHFFFAOYSA-N

SMILES: C(CCC1=CC=C(OC)C=C1)(=O)C2=C(O)C=C(O)C=C2O

Synonyms:

• 3-(4-Methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-1-propanone
• Isosakuranetin dihydrochalcone
• 1-Propanone, 3-(4-methoxyphenyl)-1-(2,4,6-trihydroxyphenyl)-

4-Methoxy-2',4',6'-trihydroxydihydrochalcone

CAS: 76172-68-4

4-Methoxy-2',4',6'-trihydroxydihydrochalcone is a dihydrochalcone derivative, which is a type of flavonoid. This compound originates mainly from the modification of natural compounds found in certain plants, specifically apples and other fruits, and is structurally related to the more commonly known sweetening agent, phlorizin. Its mode of action involves binding to taste receptors, primarily T1R2/T1R3, which are responsible for sweet taste perception. This interaction enhances the sweet taste, making it a potent non-nutritive sweetener. Due to its sweetening properties without adding calories, 4-Methoxy-2',4',6'-trihydroxydihydrochalcone is studied for potential applications in food and beverage industries where sugar reduction is essential. It also shows potential in pharmaceutical formulations to improve the palatability of medicinal compounds. Moreover, its antioxidant properties may contribute to health benefits, though further research is required to fully understand its potential therapeutic uses.

Formula: C₁₆H₁₆O₅

Purity: Min. 96 Area-%

Color and Shape: Powder

Molecular weight: 288.3 g/mol

Ref: 3D-FM66523

Isosakuranetin dihydrochalcone

CAS: 76172-68-4

Isosakuranetin dihydrochalcone is a dihydrochalcone derivative, which is a class of flavonoids. It is naturally sourced from citrus fruits, particularly found in the peels and other parts of these fruits. This compound is characterized by its unique chemical structure, which contributes to its bioactive properties.

Formula: C₁₆H₁₆O₅

Purity: Min. 95%

Molecular weight: 288.3 g/mol

Ref: 3D-XI161831