CAS 76194-00-8

2,2,5,5-tetramethyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid

Description:

2,2,5,5-Tetramethyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid, with the CAS number 76194-00-8, is an organic compound characterized by its unique structure that includes a pyrrole ring substituted with four methyl groups and a carboxylic acid functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the steric hindrance provided by the tetramethyl substituents can influence its reactivity and solubility in different solvents. Safety data indicates that, like many organic compounds, it should be handled with care, using appropriate safety measures to avoid exposure. Overall, this compound is of interest in both academic research and industrial applications due to its distinctive chemical properties.

Formula: C₉H₁₅NO₂

InChI: InChI=1/C9H15NO2/c1-8(2)5-6(7(11)12)9(3,4)10-8/h5,10H,1-4H3,(H,11,12)

SMILES: CC1(C)C=C(C(=O)O)C(C)(C)N1

Synonyms:

• 1H-Pyrrole-3-carboxylic acid, 2,5-dihydro-2,2,5,5-tetramethyl-
• 2,2,5,5-Tetramethyl-2,5-dihydro-1H-pyrrole-3-carboxylic acid

2,2,5,5-Tetramethyl-2,5-dihydro-1H-pyrrolo-3-acetic Acid

Controlled Product

CAS: 76194-00-8

Applications 2,2,5,5-Tetramethyl-2,5-dihydro-1H-pyrrolo-3-acetic Acid (cas# 76194-00-8) is a compound useful in organic synthesis.

Formula: C₉H₁₅NO₂

Color and Shape: Neat

Molecular weight: 169.22

Ref: TR-T302600