CAS 76195-83-0
:Hydrazine, (2,6-dichlorophenyl)-, hydrochloride (1:?)
Description:
Hydrazine, (2,6-dichlorophenyl)-, hydrochloride, with the CAS number 76195-83-0, is a chemical compound that belongs to the class of hydrazines, which are characterized by the presence of a hydrazine functional group (N2H4). This specific compound features a dichlorophenyl group, indicating the presence of two chlorine atoms attached to a phenyl ring at the 2 and 6 positions. As a hydrochloride salt, it is typically encountered in a solid form, which enhances its stability and solubility in water. Hydrazine derivatives are known for their applications in various fields, including pharmaceuticals, agriculture, and as reducing agents in chemical reactions. The compound may exhibit properties such as being a potential irritant to skin and eyes, and it may pose health risks if inhaled or ingested. Proper handling and safety precautions are essential when working with this substance, as it can be hazardous. Additionally, it is important to consider its environmental impact and regulatory status in different jurisdictions.
Formula:C6H6Cl2N2·xClH
InChI:InChI=1S/C6H6Cl2N2.ClH/c7-4-2-1-3-5(8)6(4)10-9;/h1-3,10H,9H2;1H
InChI key:InChIKey=CQNIYLLTIOPFCJ-UHFFFAOYSA-N
SMILES:N(N)C1=C(Cl)C=CC=C1Cl.Cl
Synonyms:- Hydrazine, (2,6-dichlorophenyl)-, hydrochloride
- Hydrazine, (2,6-dichlorophenyl)-, hydrochloride (1:?)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
