CAS 76196-67-3
:6-(Aminomethyl)-3-pyridinecarboxylic acid
Description:
6-(Aminomethyl)-3-pyridinecarboxylic acid, also known by its CAS number 76196-67-3, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an aminomethyl group (-CH2NH2) and a carboxylic acid group (-COOH) attached to the pyridine ring, specifically at the 6 and 3 positions, respectively. The presence of these functional groups contributes to its polar nature, making it soluble in water and other polar solvents. It exhibits properties typical of both amines and carboxylic acids, such as the ability to form hydrogen bonds, which can influence its reactivity and interactions in biological systems. This compound may serve as a building block in pharmaceutical synthesis or as a ligand in coordination chemistry due to its ability to coordinate with metal ions. Additionally, its structural features suggest potential applications in medicinal chemistry, particularly in the development of compounds targeting specific biological pathways.
Formula:C7H8N2O2
InChI:InChI=1S/C7H8N2O2/c8-3-6-2-1-5(4-9-6)7(10)11/h1-2,4H,3,8H2,(H,10,11)
InChI key:InChIKey=KKVJAULLCCGPBX-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=CC(CN)=NC1
Synonyms:- 3-Pyridinecarboxylic acid, 6-(aminomethyl)-
- 6-(Aminomethyl)-3-pyridinecarboxylic acid
- 6-(Aminomethyl)nicotinic acid
- 6-Aminomethylnicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.