CAS 76196-68-4
:2-Pyrimidinecarboxylic acid, 5-(bromomethyl)-, methyl ester
Description:
2-Pyrimidinecarboxylic acid, 5-(bromomethyl)-, methyl ester, identified by CAS number 76196-68-4, is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. This compound features a carboxylic acid functional group and a methyl ester group, contributing to its reactivity and solubility properties. The presence of the bromomethyl substituent at the 5-position enhances its electrophilic character, making it a potential intermediate in various synthetic pathways, particularly in the development of pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate polarity due to the ester and carboxylic acid functionalities, influencing its solubility in polar solvents. Additionally, it may participate in hydrogen bonding due to the carboxylic acid group, affecting its physical properties such as boiling and melting points. Overall, this compound's unique structure and functional groups make it a valuable building block in organic synthesis.
Formula:C7H7BrN2O2
InChI:InChI=1S/C7H7BrN2O2/c1-12-7(11)6-9-3-5(2-8)4-10-6/h3-4H,2H2,1H3
InChI key:InChIKey=DIEUUFGWUSTOIW-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1N=CC(CBr)=CN1
Synonyms:- 5-(Bromomethyl)pyrimidine-2-carboxylic acid methyl ester
- 2-Pyrimidinecarboxylic acid, 5-(bromomethyl)-, methyl ester
- Methyl 2-(bromomethyl)pyrimidine-5-carboxylate
- Methyl 5-(bromomethyl)-2-pyrimidinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-(Bromomethyl)pyrimidine-5-carboxylate
CAS:Controlled ProductFormula:C7H7BrN2O2Color and Shape:NeatMolecular weight:231.05
