CymitQuimica logo

CAS 76197-35-8

:

2,3-Anthracenedicarboxaldehyde

Description:
2,3-Anthracenedicarboxaldehyde is an organic compound characterized by its structure, which features an anthracene backbone with two aldehyde functional groups located at the 2 and 3 positions. This compound is typically a solid at room temperature and exhibits a crystalline form. It is known for its strong fluorescence properties, making it useful in various applications, including organic electronics and as a fluorescent probe in biochemical assays. The presence of the aldehyde groups contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and oxidation. Additionally, 2,3-Anthracenedicarboxaldehyde can undergo polymerization, leading to the formation of larger, more complex structures. Its solubility is generally limited in non-polar solvents, while it may dissolve better in polar organic solvents. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, 2,3-Anthracenedicarboxaldehyde is a significant compound in organic chemistry with diverse applications in research and industry.
Formula:C16H10O2
InChI:InChI=1/C16H10O2/c17-9-15-7-13-5-11-3-1-2-4-12(11)6-14(13)8-16(15)10-18/h1-10H
InChI key:InChIKey=HTKKRNQMBYGFMV-UHFFFAOYSA-N
SMILES:C(=O)C1=CC2=C(C=C3C(=C2)C=CC=C3)C=C1C=O
Synonyms:
  • Anthracene-2,3-dicarbaldehyde
  • Anthracene-2,3-dicarboxaldehyde
  • 2,3-Anthracenedicarboxaldehyde
  • Anthracene-2,3-dicarbaldehyde
  • 2,3-anthracenedicarboxaldehyde
  • 2,3-Diformylanthracene
  • Anthracene-2,3-dialdehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.