CymitQuimica logo

CAS 76198-36-2

:

3-aminobicyclo[2.2.1]heptane-2-carboxylic acid

Description:
3-Aminobicyclo[2.2.1]heptane-2-carboxylic acid, also known by its CAS number 76198-36-2, is a bicyclic compound characterized by a bicyclo[2.2.1]heptane framework with an amino group and a carboxylic acid functional group. This compound features a rigid structure due to its bicyclic nature, which can influence its reactivity and interactions with biological systems. The presence of the amino group makes it a potential candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can participate in hydrogen bonding and interact with biological targets. The carboxylic acid group contributes to its acidity and solubility in polar solvents, enhancing its potential for biological activity. Additionally, the stereochemistry of the compound can play a significant role in its pharmacological properties, making it an interesting subject for further research in drug design and synthesis. Overall, 3-aminobicyclo[2.2.1]heptane-2-carboxylic acid is a compound of interest due to its unique structural features and potential applications in various fields.
Formula:C8H13NO2
InChI:InChI=1/C8H13NO2/c9-7-5-2-1-4(3-5)6(7)8(10)11/h4-7H,1-3,9H2,(H,10,11)
SMILES:C1CC2CC1C(C2N)C(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.