CAS 76198-37-3

3-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid

Description:

3-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid, with the CAS number 76198-37-3, is a bicyclic compound characterized by its unique structural features. This substance contains a bicyclo[2.2.1]heptane core, which contributes to its rigidity and potential for specific interactions in biological systems. The presence of an amino group and a carboxylic acid functional group indicates that it can participate in various chemical reactions, including peptide bond formation and acid-base reactions. The dimethylethoxycarbonyl group enhances its stability and solubility, making it suitable for various applications in organic synthesis and medicinal chemistry. Additionally, the compound's stereochemistry may influence its biological activity, making it a subject of interest in drug design and development. Overall, this compound exemplifies the complexity and diversity of organic molecules, particularly those with potential pharmaceutical applications.

Formula: C₁₃H₂₁NO₄

InChI: InChI=1S/C13H21NO4/c1-13(2,3)18-12(17)14-10-8-5-4-7(6-8)9(10)11(15)16/h7-10H,4-6H2,1-3H3,(H,14,17)(H,15,16)

InChI key: InChIKey=BWIMUIWFDXMFLE-UHFFFAOYSA-N

SMILES: N(C(OC(C)(C)C)=O)C1C2CC(C1C(O)=O)CC2

Synonyms:

• 3-[[(tert-Butoxy)carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid
• 3-[[(1,1-Dimethylethoxy)carbonyl]amino]bicyclo[2.2.1]heptane-2-carboxylic acid
• Bicyclo[2.2.1]heptane-2-carboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-

Boc-3-exo-aminobicyclo[2.2.1]-heptane-2-exo-carboxylic acid

CAS: 76198-37-3

Versatile small molecule scaffold

Formula: C₁₃H₂₁NO₄

Purity: Min. 95%

Molecular weight: 255.32 g/mol

Ref: 3D-BDA19837