CAS 7620-75-9
:9-Octadecenoic acid (9Z)-, compd. with N-butyl-1-butanamine (1:1)
Description:
9-Octadecenoic acid (9Z)-, also known as oleic acid, is a monounsaturated fatty acid characterized by a long hydrocarbon chain with a double bond located at the ninth carbon from the carboxylic end, which gives it its unsaturated nature. This compound is typically found in various animal and vegetable fats and oils, contributing to their nutritional and functional properties. When combined with N-butyl-1-butanamine in a 1:1 ratio, the resulting compound exhibits unique characteristics, including altered solubility and potential applications in surfactants or emulsifiers. The presence of both the fatty acid and the amine can enhance the compound's ability to interact with biological membranes or facilitate the formation of micelles. The CAS number 7620-75-9 identifies this specific compound, which may be of interest in fields such as biochemistry, pharmaceuticals, and materials science. Overall, the combination of oleic acid and butylamine can lead to interesting properties that may be exploited in various industrial and research applications.
Formula:C18H34O2·C8H19N
InChI:InChI=1S/C18H34O2.C8H19N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-7-9-8-6-4-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);9H,3-8H2,1-2H3/b10-9-;
InChI key:InChIKey=FJKPGTVTPYZWCM-KVVVOXFISA-N
SMILES:C(C/C=C\CCCCCCCC)CCCCCC(O)=O.N(CCCC)CCCC
Synonyms:- 1-Butanamine, N-butyl-, (9Z)-9-octadecenoate
- 9-Octadecenoic acid (9Z)-, compd. with N-butyl-1-butanamine (1:1)
- 1-Butanamine, N-butyl-, (Z)-9-octadecenoate
- 9-Octadecenoic acid (Z)-, compd. with N-butyl-1-butanamine (1:1)
- Oleic acid, compd. with dibutylamine (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
