CymitQuimica logo

CAS 76201-95-1

:

3-hydroxy-1-methyl-1-azoniabicyclo[2.2.2]octane

Description:
3-Hydroxy-1-methyl-1-azoniabicyclo[2.2.2]octane, also known by its CAS number 76201-95-1, is a quaternary ammonium compound characterized by a bicyclic structure that incorporates a nitrogen atom within a saturated ring system. This compound features a hydroxyl group (-OH) and a methyl group (-CH3) attached to the nitrogen, contributing to its solubility in polar solvents. The bicyclo[2.2.2]octane framework provides a unique three-dimensional shape, which can influence its biological activity and interactions with other molecules. As a quaternary ammonium compound, it typically exhibits cationic properties, making it potentially useful in various applications, including as a surfactant, antimicrobial agent, or in drug design. Its stability and reactivity can be influenced by the presence of the hydroxyl group, which may participate in hydrogen bonding and affect its overall polarity. Understanding the characteristics of this compound is essential for exploring its potential uses in pharmaceuticals and materials science.
Formula:C8H16NO
InChI:InChI=1/C8H16NO/c1-9-4-2-7(3-5-9)8(10)6-9/h7-8,10H,2-6H2,1H3/q+1
SMILES:CN12CCC(CC1)C(C2)O
Synonyms:
  • 1-Azoniabicyclo[2.2.2]octane, 3-hydroxy-1-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.