CAS 76204-02-9: 4-methylumbelliferyl-N-acetyl-alpha-D-neuram.A.so-S.dihy.
Description:4-Methylumbelliferyl-N-acetyl-alpha-D-neuraminate, commonly referred to as 4-MU-NANA, is a synthetic substrate used primarily in biochemical assays to detect neuraminidase activity. This compound features a 4-methylumbelliferone moiety, which is a fluorescent marker, allowing for sensitive detection when the substrate is hydrolyzed by neuraminidase enzymes. The presence of the N-acetyl-alpha-D-neuraminate structure makes it a specific substrate for enzymes that cleave sialic acid residues. Upon enzymatic action, the release of 4-methylumbelliferone results in a measurable increase in fluorescence, facilitating quantitative analysis. This compound is particularly valuable in virology and microbiology for studying pathogens that express neuraminidase, such as influenza viruses. Additionally, its stability and solubility in aqueous solutions make it suitable for various laboratory applications. Overall, 4-MU-NANA serves as an important tool in research and diagnostic settings, contributing to our understanding of sialic acid metabolism and enzyme kinetics.
Formula:C21H24NNaO11
InChI:InChI=1/C21H25NO11.Na/c1-9-5-16(27)31-15-6-11(3-4-12(9)15)32-21(20(29)30)7-13(25)17(22-10(2)24)19(33-21)18(28)14(26)8-23;/h3-6,13-14,17-19,23,25-26,28H,7-8H2,1-2H3,(H,22,24)(H,29,30);/q;+1/p-1/t13?,14-,17?,18-,19?,21?;/m1./s1
- Synonyms:
- 2-(4-Methylumbelliferyl)-a-D-N-acetylneuraminic acid, sodium salt
- 2-(4-methylumbelliferyl)-A-D-N-*acetylneuraminic
- 2'-(4-Methylumbelliferyl)-Alpha-D-N-Acetylneuraminic Acid Sodium Salt