CymitQuimica logo

CAS 76207-83-5

:

herbimycin B

Description:
Herbimycin B is a natural product belonging to the class of compounds known as ansamycins, which are characterized by their unique bicyclic structure. It is primarily known for its antibiotic properties and has been studied for its potential as an antitumor agent. The compound exhibits a complex molecular structure that includes a polyketide backbone, contributing to its biological activity. Herbimycin B functions by inhibiting the activity of heat shock protein 90 (Hsp90), a chaperone protein involved in the stabilization and function of various client proteins, many of which are implicated in cancer progression. This inhibition can lead to the degradation of oncogenic proteins, making it a subject of interest in cancer research. Additionally, herbimycin B has shown activity against certain bacterial strains, highlighting its dual role as both an antibiotic and an anticancer agent. Its synthesis and modification have been explored to enhance its efficacy and reduce potential side effects, making it a valuable compound in medicinal chemistry and pharmacology.
Formula:C28H38N2O8
InChI:InChI=1/C28H38N2O8/c1-15-10-19-13-20(31)14-21(25(19)33)30-27(34)16(2)8-7-9-22(36-5)26(38-28(29)35)18(4)12-17(3)24(32)23(11-15)37-6/h7-9,12-15,17,22-24,26,32H,10-11H2,1-6H3,(H2,29,35)(H,30,34)/b9-7-,16-8-,18-12+
Synonyms:
  • herbimycin B
  • See more synonyms
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Herbimycin B

    CAS:
    Herbimycin B, an ansamycin antibiotic, functions as an inhibitor of Src family kinases. It exhibits herbicidal effects on most monocotyledonous and dicotyledonous plants and can inhibit the activity of tobacco mosaic virus (TMV), HeLa cells, and Ehrlich cells.
    Formula:C29H40N2O7
    Color and Shape:Solid
    Molecular weight:528.637

    Ref: TM-TN10532

    10mg
    To inquire
    50mg
    To inquire