CymitQuimica logo

CAS 7621-95-6

:

methyl N-(diphenylacetyl)phenylalaninate

Description:
Methyl N-(diphenylacetyl)phenylalaninate, with the CAS number 7621-95-6, is an organic compound that belongs to the class of amino acid derivatives. It features a phenylalanine backbone, which is an essential amino acid, modified by the addition of a diphenylacetyl group and a methyl ester functionality. This compound is typically characterized by its relatively high molecular weight and complex structure, which includes aromatic rings that contribute to its stability and potential biological activity. Methyl N-(diphenylacetyl)phenylalaninate may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, typical of many aromatic compounds. Its structure suggests potential applications in pharmaceuticals, particularly in drug design and synthesis, due to the presence of both amino acid and aromatic moieties that can interact with biological targets. Additionally, the compound may be studied for its role in various chemical reactions, including esterification and acylation processes. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards.
Formula:C24H23NO3
InChI:InChI=1/C24H23NO3/c1-28-24(27)21(17-18-11-5-2-6-12-18)25-23(26)22(19-13-7-3-8-14-19)20-15-9-4-10-16-20/h2-16,21-22H,17H2,1H3,(H,25,26)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.