CAS 76211-71-7
:2-acetamido-2-deoxy-4-O-A-L-*fucopyranosyl-D-gluc
Description:
2-Acetamido-2-deoxy-4-O-A-L-fucopyranosyl-D-gluc is a glycosylated amino sugar that belongs to the class of carbohydrates. It features an acetamido group, which contributes to its solubility and biological activity. The presence of the fucopyranosyl moiety indicates that it contains a fucose sugar unit, which is often involved in various biological processes, including cell recognition and signaling. This compound is typically found in glycoproteins and glycolipids, playing a crucial role in cellular interactions and immune responses. Its structural complexity allows for various stereochemical configurations, which can influence its reactivity and interactions with other biomolecules. The CAS number 76211-71-7 uniquely identifies this compound in chemical databases, facilitating its study and application in research, particularly in biochemistry and medicinal chemistry. Overall, this substance is significant in the context of glycobiology and may have potential applications in drug development and therapeutic interventions.
Formula:C14H25NO10
InChI:InChI=1/C14H25NO10/c1-4-8(18)10(20)11(21)14(23-4)25-12-6(3-16)24-13(22)7(9(12)19)15-5(2)17/h4,6-14,16,18-22H,3H2,1-2H3,(H,15,17)/t4?,6?,7-,8+,9+,10-,11-,12+,13+,14-/m0/s1
Synonyms:- 2-Acetamido-2-Deoxy-4-O-(a-L-Fucopyranosyl)-D-Glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Acetamido-2-deoxy-4-O-(α-L-fucopyranosyl)-D-glucopyranose
CAS:2-Acetamido-2-deoxy-4-O-(α-L-fucopyranosyl)-D-glucopyranosePurity:≥95%Molecular weight:367.35g/mol2-Acetamido-2-deoxy-4-O-(a-L-fucopyranosyl)-D-glucopyranose
CAS:<p>2-Acetamido-2-deoxy-4-O-(a-L-fucopyranosyl)-D-glucopyranose is a methylated, custom synthesized oligosaccharide. It has been modified to include a fluorine atom at the C4 position on the glucose residue. The product is highly pure and in crystalline form, with a CAS number of 76211-71-7.</p>Formula:C14H25NO10Purity:90%Color and Shape:White PowderMolecular weight:367.35 g/mol2-Acetamido-2-deoxy-4-O-(α-L-fucopyranosyl)-D-glucopyranose
CAS:Controlled Product<p>Applications Oligosaccharide which participates in cell adhesion between bacterial and eukaryotic cells<br>References Perret, S., et al.: Biochem. J., 389, 325 (2005), Marotte, K., et al.: ChemMedChem., 2, 1328 (2007),<br></p>Formula:C14H25NO10Color and Shape:NeatMolecular weight:367.35



