CymitQuimica logo

CAS 76211-92-2

:

2-(3,5-dimethyl-1H-pyrazol-1-yl)-5-nitropyridine

Description:
2-(3,5-Dimethyl-1H-pyrazol-1-yl)-5-nitropyridine, with the CAS number 76211-92-2, is an organic compound characterized by its complex structure that includes a pyridine ring substituted with both a nitro group and a pyrazole moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, reflecting its non-polar characteristics. The presence of the nitro group contributes to its potential as a nitrating agent, while the pyrazole ring may impart specific biological or pharmacological activities. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, making it of interest in synthetic organic chemistry. Additionally, due to its unique functional groups, it may exhibit interesting properties such as fluorescence or specific reactivity patterns, which could be explored in various applications, including pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as nitro compounds can be sensitive to heat and shock.
Formula:C10H10N4O2
InChI:InChI=1/C10H10N4O2/c1-7-5-8(2)13(12-7)10-4-3-9(6-11-10)14(15)16/h3-6H,1-2H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.