CAS 762180-94-9

1-(propan-2-yl)piperidine-3-carboxylic acid

Description:

1-(Propan-2-yl)piperidine-3-carboxylic acid, also known by its CAS number 762180-94-9, is a chemical compound characterized by its piperidine ring structure, which is a six-membered nitrogen-containing heterocycle. This compound features a propan-2-yl group (isopropyl) attached to the nitrogen of the piperidine ring, along with a carboxylic acid functional group at the 3-position of the ring. The presence of the isopropyl group contributes to its hydrophobic characteristics, while the carboxylic acid group imparts acidic properties, making it soluble in polar solvents. This compound may exhibit biological activity, potentially serving as a building block in pharmaceutical synthesis or as a ligand in medicinal chemistry. Its structural features suggest it could participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and potential applications. As with many piperidine derivatives, it may also exhibit interesting pharmacological properties, warranting further investigation in drug development contexts.

Formula: C₉H₁₇NO₂

InChI: InChI=1/C9H17NO2/c1-7(2)10-5-3-4-8(6-10)9(11)12/h7-8H,3-6H2,1-2H3,(H,11,12)

SMILES: CC(C)N1CCCC(C1)C(=O)O

Synonyms:

• 3-Piperidinecarboxylic Acid, 1-(1-Methylethyl)-