CAS 7622-21-1
:benzyl (2S)-2-hydroxy-3-phenylpropanoate
Description:
Benzyl (2S)-2-hydroxy-3-phenylpropanoate, with the CAS number 7622-21-1, is an organic compound characterized by its ester functional group. It is derived from the reaction of benzyl alcohol and (2S)-2-hydroxy-3-phenylpropanoic acid. This compound typically appears as a colorless to pale yellow liquid with a pleasant aromatic odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic benzyl and phenyl groups. The presence of the hydroxyl group contributes to its potential as a chiral building block in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Additionally, its stereochemistry (2S configuration) plays a crucial role in determining its biological activity and interactions. As with many organic compounds, it should be handled with care, observing appropriate safety protocols to mitigate any risks associated with exposure or reactivity.
Formula:C16H16O3
InChI:InChI=1/C16H16O3/c17-15(11-13-7-3-1-4-8-13)16(18)19-12-14-9-5-2-6-10-14/h1-10,15,17H,11-12H2/t15-/m0/s1
SMILES:c1ccc(cc1)C[C@@H](C(=O)OCc1ccccc1)O
Synonyms:- 7622-21-1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
