CymitQuimica logo

CAS 76220-95-6

:

3-Methylene-2-pyrrolidinone

Description:
3-Methylene-2-pyrrolidinone, with the CAS number 76220-95-6, is a cyclic amide and a derivative of pyrrolidinone. This compound features a five-membered ring structure that includes a nitrogen atom and a carbonyl group, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid with a characteristic odor. The presence of the methylene group enhances its reactivity, making it a useful intermediate in organic synthesis and a potential solvent in various chemical processes. 3-Methylene-2-pyrrolidinone is known for its polar nature, which allows it to dissolve a wide range of organic compounds. Additionally, it exhibits moderate volatility and can participate in various chemical reactions, including nucleophilic additions and polymerization processes. Safety data indicates that, like many organic solvents, it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is valued in both industrial and research settings for its versatile chemical behavior.
Formula:C5H7NO
InChI:InChI=1S/C5H7NO/c1-4-2-3-6-5(4)7/h1-3H2,(H,6,7)
InChI key:InChIKey=FEFAOCZERLVSIS-UHFFFAOYSA-N
SMILES:C=C1C(=O)NCC1
Synonyms:
  • 3-Methylidenepyrrolidin-2-one
  • 2-Pyrrolidinone, 3-methylene-
  • 3-Methylene-2-pyrrolidinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.