CAS 762240-09-5

4-(1H-pyrazol-1-yl)piperidine

Description:

4-(1H-pyrazol-1-yl)piperidine is a chemical compound characterized by its unique structure, which includes a piperidine ring and a pyrazole moiety. The piperidine ring is a six-membered saturated nitrogen-containing heterocycle, while the pyrazole is a five-membered ring with two adjacent nitrogen atoms. This compound is often studied for its potential biological activities, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. Its molecular structure contributes to its properties, including solubility and reactivity, which can be influenced by the presence of functional groups and the arrangement of atoms. The compound may exhibit various interactions with biological targets, making it of interest in drug discovery and development. Additionally, its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its purity and structural integrity. Overall, 4-(1H-pyrazol-1-yl)piperidine represents a valuable compound in the field of organic and medicinal chemistry.

Formula: C₈H₁₃N₃

InChI: InChI=1/C8H13N3/c1-4-10-11(7-1)8-2-5-9-6-3-8/h1,4,7-9H,2-3,5-6H2

SMILES: c1cnn(c1)C1CCNCC1

4-(Pyrazol-1-yl)piperidine

CAS: 762240-09-5

Formula: C₈H₁₃N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 151.2089

Ref: IN-DA008O9A

4-(1H-Pyrazol-1-yl)piperidine

CAS: 762240-09-5

4-(1H-Pyrazol-1-yl)piperidine

Purity: 98%

Molecular weight: 151.21g/mol

Ref: 54-OR75111

4-(1H-Pyrazol-1-yl)piperidine

CAS: 762240-09-5

Formula: C₈H₁₃N₃

Purity: 95%

Color and Shape: Solid, Yellow powder

Molecular weight: 151.213

Ref: 10-F216962