
CAS 762272-47-9
:2-Methyl-3-pyridinethiol
Description:
2-Methyl-3-pyridinethiol, also known by its CAS number 762272-47-9, is an organic compound that features a pyridine ring substituted with a methyl group and a thiol (-SH) functional group. This compound is characterized by its distinct aromatic properties due to the presence of the pyridine ring, which contributes to its potential reactivity and interactions in various chemical environments. The thiol group imparts unique characteristics, such as the ability to form disulfide bonds and participate in redox reactions, making it relevant in biochemical processes and synthetic applications. 2-Methyl-3-pyridinethiol is typically a colorless to yellow liquid with a strong, sulfurous odor, indicative of its thiol content. It is soluble in organic solvents and may exhibit moderate solubility in water. This compound is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and utility as a building block in organic synthesis. Safety precautions should be observed when handling this substance, as thiols can be toxic and irritating.
Formula:C6H7NS
InChI:InChI=1S/C6H7NS/c1-5-6(8)3-2-4-7-5/h2-4,8H,1H3
InChI key:InChIKey=CGQWZVMVSJLPKO-UHFFFAOYSA-N
SMILES:SC1=C(C)N=CC=C1
Synonyms:- 2-Methyl-3-pyridinethiol
- 2-Methylpyridine-3-thiol
- 3-Pyridinethiol, 2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.