CAS 762272-49-1

5-Methyl-3-pyridinethiol

Description:

5-Methyl-3-pyridinethiol, with the CAS number 762272-49-1, is an organic compound that belongs to the class of pyridinethiols. It features a pyridine ring substituted with a methyl group and a thiol (-SH) functional group, which contributes to its distinct chemical properties. This compound is typically characterized by its aromatic nature, which can influence its reactivity and interactions with other substances. The presence of the thiol group makes it a potential candidate for various applications, including as a reducing agent or in the synthesis of other chemical compounds. Additionally, thiols are known for their strong odors, often described as sulfurous or garlic-like, which may also apply to this compound. Its solubility in organic solvents and limited solubility in water are typical for thiol-containing compounds. Overall, 5-Methyl-3-pyridinethiol is of interest in both synthetic chemistry and potential applications in pharmaceuticals or agrochemicals due to its unique structural features.

Formula: C₆H₇NS

InChI: InChI=1S/C6H7NS/c1-5-2-6(8)4-7-3-5/h2-4,8H,1H3

InChI key: InChIKey=NTYHFXOCIUBEJO-UHFFFAOYSA-N

SMILES: CC=1C=C(S)C=NC1

Synonyms:

• 3-Pyridinethiol, 5-methyl-
• 5-Methyl-3-pyridinethiol